C38H33NO4S — CID 118360141
[(Z)-[1-[4-[4-(naphthalene-2-carbonyl)phenyl]sulfanylphenyl]-1-oxooctan-2-ylidene]amino] benzoate (PubChem CID 118360141) has the molecular formula C38H33NO4S and a molecular weight of 599.75 g/mol. Its IUPAC name is [(Z)-[1-[4-[4-(naphthalene-2-carbonyl)phenyl]sulfanylphenyl]-1-oxooctan-2-ylidene]amino] benzoate.
| Compound Name | [(Z)-[1-[4-[4-(naphthalene-2-carbonyl)phenyl]sulfanylphenyl]-1-oxooctan-2-ylidene]amino] benzoate |
|---|---|
| PubChem CID | 118360141 |
| Molecular Formula | C38H33NO4S |
| Molecular Weight | 599.75 g/mol |
| Exact Mass | 599.21 |
| IUPAC Name | [(Z)-[1-[4-[4-(naphthalene-2-carbonyl)phenyl]sulfanylphenyl]-1-oxooctan-2-ylidene]amino] benzoate |
| SMILES | CCCCCC/C(=N/OC(=O)c1ccccc1)C(=O)c1ccc(Sc2ccc(C(=O)c3ccc4ccccc4c3)cc2)cc1 |
| InChI | InChI=1S/C38H33NO4S/c1-2-3-4-8-15-35(39-43-38(42)30-12-6-5-7-13-30)37(41)29-20-24-34(25-21-29)44-33-22-18-28(19-23-33)36(40)32-17-16-27-11-9-10-14-31(27)26-32/h5-7,9-14,16-26H,2-4,8,15H2,1H3/b39-35- |
| InChIKey | AIDXNHIFZAWNHZ-ICKFRXAFSA-N |
| XLogP | 9.59 |
| TPSA | 72.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.75 |
| LogP ≤ 5 | 9.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|