C26H25NO3S — CID 59248448
[(E)-[1-oxo-1-(4-phenylsulfanylphenyl)heptan-2-ylidene]amino] benzoate (PubChem CID 59248448) has the molecular formula C26H25NO3S and a molecular weight of 431.56 g/mol. Its IUPAC name is [(E)-[1-oxo-1-(4-phenylsulfanylphenyl)heptan-2-ylidene]amino] benzoate.
| Compound Name | [(E)-[1-oxo-1-(4-phenylsulfanylphenyl)heptan-2-ylidene]amino] benzoate |
|---|---|
| PubChem CID | 59248448 |
| Molecular Formula | C26H25NO3S |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | [(E)-[1-oxo-1-(4-phenylsulfanylphenyl)heptan-2-ylidene]amino] benzoate |
| SMILES | CCCCC/C(=N\OC(=O)c1ccccc1)C(=O)c1ccc(Sc2ccccc2)cc1 |
| InChI | InChI=1S/C26H25NO3S/c1-2-3-6-15-24(27-30-26(29)21-11-7-4-8-12-21)25(28)20-16-18-23(19-17-20)31-22-13-9-5-10-14-22/h4-5,7-14,16-19H,2-3,6,15H2,1H3/b27-24+ |
| InChIKey | YYWWBHUDCOHXJS-SOYKGTTHSA-N |
| XLogP | 6.81 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|