C27H27NO5S2 — CID 175013412
[[1-oxo-1-(4-phenylsulfanylsulfonylphenyl)octan-2-ylidene]amino] benzoate (PubChem CID 175013412) has the molecular formula C27H27NO5S2 and a molecular weight of 509.65 g/mol. Its IUPAC name is [[1-oxo-1-(4-phenylsulfanylsulfonylphenyl)octan-2-ylidene]amino] benzoate.
| Compound Name | [[1-oxo-1-(4-phenylsulfanylsulfonylphenyl)octan-2-ylidene]amino] benzoate |
|---|---|
| PubChem CID | 175013412 |
| Molecular Formula | C27H27NO5S2 |
| Molecular Weight | 509.65 g/mol |
| Exact Mass | 509.13 |
| IUPAC Name | [[1-oxo-1-(4-phenylsulfanylsulfonylphenyl)octan-2-ylidene]amino] benzoate |
| SMILES | CCCCCCC(=NOC(=O)c1ccccc1)C(=O)c1ccc(S(=O)(=O)Sc2ccccc2)cc1 |
| InChI | InChI=1S/C27H27NO5S2/c1-2-3-4-11-16-25(28-33-27(30)22-12-7-5-8-13-22)26(29)21-17-19-24(20-18-21)35(31,32)34-23-14-9-6-10-15-23/h5-10,12-15,17-20H,2-4,11,16H2,1H3 |
| InChIKey | RWZQNRKNCVBUPC-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 89.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.65 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|