C34H31NO5S — CID 118902051
[(E)-[4-cyclohexyl-1-[4-[4-(furan-2-carbonyl)phenyl]sulfanylphenyl]-1-oxobutan-2-ylidene]amino] benzoate (PubChem CID 118902051) has the molecular formula C34H31NO5S and a molecular weight of 565.69 g/mol. Its IUPAC name is [(E)-[4-cyclohexyl-1-[4-[4-(furan-2-carbonyl)phenyl]sulfanylphenyl]-1-oxobutan-2-ylidene]amino] benzoate.
| Compound Name | [(E)-[4-cyclohexyl-1-[4-[4-(furan-2-carbonyl)phenyl]sulfanylphenyl]-1-oxobutan-2-ylidene]amino] benzoate |
|---|---|
| PubChem CID | 118902051 |
| Molecular Formula | C34H31NO5S |
| Molecular Weight | 565.69 g/mol |
| Exact Mass | 565.19 |
| IUPAC Name | [(E)-[4-cyclohexyl-1-[4-[4-(furan-2-carbonyl)phenyl]sulfanylphenyl]-1-oxobutan-2-ylidene]amino] benzoate |
| SMILES | O=C(O/N=C(\CCC1CCCCC1)C(=O)c1ccc(Sc2ccc(C(=O)c3ccco3)cc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C34H31NO5S/c36-32(30(22-13-24-8-3-1-4-9-24)35-40-34(38)27-10-5-2-6-11-27)25-14-18-28(19-15-25)41-29-20-16-26(17-21-29)33(37)31-12-7-23-39-31/h2,5-7,10-12,14-21,23-24H,1,3-4,8-9,13,22H2/b35-30+ |
| InChIKey | IROQRIFJDHDPCS-WUZYOQQESA-N |
| XLogP | 8.42 |
| TPSA | 85.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.69 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|