C27H27NO3S — CID 172923043
[(Z)-[1-(4-cyclohexa-1,3-dien-1-ylsulfanylphenyl)-3-cyclopentyl-1-oxopropan-2-ylidene]amino] benzoate (PubChem CID 172923043) has the molecular formula C27H27NO3S and a molecular weight of 445.58 g/mol. Its IUPAC name is [(Z)-[1-(4-cyclohexa-1,3-dien-1-ylsulfanylphenyl)-3-cyclopentyl-1-oxopropan-2-ylidene]amino] benzoate.
| Compound Name | [(Z)-[1-(4-cyclohexa-1,3-dien-1-ylsulfanylphenyl)-3-cyclopentyl-1-oxopropan-2-ylidene]amino] benzoate |
|---|---|
| PubChem CID | 172923043 |
| Molecular Formula | C27H27NO3S |
| Molecular Weight | 445.58 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | [(Z)-[1-(4-cyclohexa-1,3-dien-1-ylsulfanylphenyl)-3-cyclopentyl-1-oxopropan-2-ylidene]amino] benzoate |
| SMILES | O=C(O/N=C(/CC1CCCC1)C(=O)c1ccc(SC2=CC=CCC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C27H27NO3S/c29-26(21-15-17-24(18-16-21)32-23-13-5-2-6-14-23)25(19-20-9-7-8-10-20)28-31-27(30)22-11-3-1-4-12-22/h1-5,11-13,15-18,20H,6-10,14,19H2/b28-25- |
| InChIKey | GNOUWKZUOAZLHO-FVDSYPCUSA-N |
| XLogP | 6.99 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.58 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|