C26H25NO2 — CID 5021428
[[phenyl-(4-phenylphenyl)methylidene]amino] cyclohexanecarboxylate (PubChem CID 5021428) has the molecular formula C26H25NO2 and a molecular weight of 383.49 g/mol. Its IUPAC name is [[phenyl-(4-phenylphenyl)methylidene]amino] cyclohexanecarboxylate.
| Compound Name | [[phenyl-(4-phenylphenyl)methylidene]amino] cyclohexanecarboxylate |
|---|---|
| PubChem CID | 5021428 |
| Molecular Formula | C26H25NO2 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | [[phenyl-(4-phenylphenyl)methylidene]amino] cyclohexanecarboxylate |
| SMILES | O=C(ON=C(c1ccccc1)c1ccc(-c2ccccc2)cc1)C1CCCCC1 |
| InChI | InChI=1S/C26H25NO2/c28-26(24-14-8-3-9-15-24)29-27-25(22-12-6-2-7-13-22)23-18-16-21(17-19-23)20-10-4-1-5-11-20/h1-2,4-7,10-13,16-19,24H,3,8-9,14-15H2 |
| InChIKey | RDIVGVILVABHFA-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|