C39H39N3O5S — CID 76562873
[[1-[6-[4-(3,5-dimethylmorpholin-4-yl)benzoyl]-9-ethylcarbazol-3-yl]-1-oxo-4-phenylsulfanylbutan-2-ylidene]amino] acetate (PubChem CID 76562873) has the molecular formula C39H39N3O5S and a molecular weight of 661.82 g/mol. Its IUPAC name is [[1-[6-[4-(3,5-dimethylmorpholin-4-yl)benzoyl]-9-ethylcarbazol-3-yl]-1-oxo-4-phenylsulfanylbutan-2-ylidene]amino] acetate.
| Compound Name | [[1-[6-[4-(3,5-dimethylmorpholin-4-yl)benzoyl]-9-ethylcarbazol-3-yl]-1-oxo-4-phenylsulfanylbutan-2-ylidene]amino] acetate |
|---|---|
| PubChem CID | 76562873 |
| Molecular Formula | C39H39N3O5S |
| Molecular Weight | 661.82 g/mol |
| Exact Mass | 661.26 |
| IUPAC Name | [[1-[6-[4-(3,5-dimethylmorpholin-4-yl)benzoyl]-9-ethylcarbazol-3-yl]-1-oxo-4-phenylsulfanylbutan-2-ylidene]amino] acetate |
| SMILES | CCn1c2ccc(C(=O)C(CCSc3ccccc3)=NOC(C)=O)cc2c2cc(C(=O)c3ccc(N4C(C)COCC4C)cc3)ccc21 |
| InChI | InChI=1S/C39H39N3O5S/c1-5-41-36-17-13-29(38(44)28-11-15-31(16-12-28)42-25(2)23-46-24-26(42)3)21-33(36)34-22-30(14-18-37(34)41)39(45)35(40-47-27(4)43)19-20-48-32-9-7-6-8-10-32/h6-18,21-22,25-26H,5,19-20,23-24H2,1-4H3 |
| InChIKey | KZYGGUZMOSBMPN-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 90.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.82 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|