C34H32N2O4S — CID 58527849
[(E)-[4-cyclohexa-2,4-dien-1-ylsulfanyl-1-[9-ethyl-6-(2-methylbenzoyl)carbazol-3-yl]-1-oxobutan-2-ylidene]amino] acetate (PubChem CID 58527849) has the molecular formula C34H32N2O4S and a molecular weight of 564.71 g/mol. Its IUPAC name is [(E)-[4-cyclohexa-2,4-dien-1-ylsulfanyl-1-[9-ethyl-6-(2-methylbenzoyl)carbazol-3-yl]-1-oxobutan-2-ylidene]amino] acetate.
| Compound Name | [(E)-[4-cyclohexa-2,4-dien-1-ylsulfanyl-1-[9-ethyl-6-(2-methylbenzoyl)carbazol-3-yl]-1-oxobutan-2-ylidene]amino] acetate |
|---|---|
| PubChem CID | 58527849 |
| Molecular Formula | C34H32N2O4S |
| Molecular Weight | 564.71 g/mol |
| Exact Mass | 564.21 |
| IUPAC Name | [(E)-[4-cyclohexa-2,4-dien-1-ylsulfanyl-1-[9-ethyl-6-(2-methylbenzoyl)carbazol-3-yl]-1-oxobutan-2-ylidene]amino] acetate |
| SMILES | CCn1c2ccc(C(=O)/C(CCSC3C=CC=CC3)=N/OC(C)=O)cc2c2cc(C(=O)c3ccccc3C)ccc21 |
| InChI | InChI=1S/C34H32N2O4S/c1-4-36-31-16-14-24(33(38)27-13-9-8-10-22(27)2)20-28(31)29-21-25(15-17-32(29)36)34(39)30(35-40-23(3)37)18-19-41-26-11-6-5-7-12-26/h5-11,13-17,20-21,26H,4,12,18-19H2,1-3H3/b35-30+ |
| InChIKey | FRTAYJWTACXGJJ-WUZYOQQESA-N |
| XLogP | 7.46 |
| TPSA | 77.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.71 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|