C34H32N2O5S — CID 144983482
[(E)-[1-[9-ethyl-6-(2-methylcyclohexa-1,5-diene-1-carbonyl)carbazol-3-yl]-4-(4-hydroxyphenyl)sulfanyl-1-oxobutan-2-ylidene]amino] acetate (PubChem CID 144983482) has the molecular formula C34H32N2O5S and a molecular weight of 580.71 g/mol. Its IUPAC name is [(E)-[1-[9-ethyl-6-(2-methylcyclohexa-1,5-diene-1-carbonyl)carbazol-3-yl]-4-(4-hydroxyphenyl)sulfanyl-1-oxobutan-2-ylidene]amino] acetate.
| Compound Name | [(E)-[1-[9-ethyl-6-(2-methylcyclohexa-1,5-diene-1-carbonyl)carbazol-3-yl]-4-(4-hydroxyphenyl)sulfanyl-1-oxobutan-2-ylidene]amino] acetate |
|---|---|
| PubChem CID | 144983482 |
| Molecular Formula | C34H32N2O5S |
| Molecular Weight | 580.71 g/mol |
| Exact Mass | 580.20 |
| IUPAC Name | [(E)-[1-[9-ethyl-6-(2-methylcyclohexa-1,5-diene-1-carbonyl)carbazol-3-yl]-4-(4-hydroxyphenyl)sulfanyl-1-oxobutan-2-ylidene]amino] acetate |
| SMILES | CCn1c2ccc(C(=O)C3=C(C)CCC=C3)cc2c2cc(C(=O)/C(CCSc3ccc(O)cc3)=N/OC(C)=O)ccc21 |
| InChI | InChI=1S/C34H32N2O5S/c1-4-36-31-15-9-23(33(39)27-8-6-5-7-21(27)2)19-28(31)29-20-24(10-16-32(29)36)34(40)30(35-41-22(3)37)17-18-42-26-13-11-25(38)12-14-26/h6,8-16,19-20,38H,4-5,7,17-18H2,1-3H3/b35-30+ |
| InChIKey | FVALXPQWXQYPFJ-WUZYOQQESA-N |
| XLogP | 7.65 |
| TPSA | 97.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.71 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|