C52H62ClN2O9+ — CID 159593255
ethyl 2-chloro-2-oxoacetate;ethyl 2-[6-(2-ethoxy-2-oxoacetyl)-9-(2-ethylhexyl)carbazol-3-yl]-2-oxoacetate;9-(2-ethylhexyl)carbazole (PubChem CID 159593255) has the molecular formula C52H62ClN2O9+ and a molecular weight of 894.53 g/mol. Its IUPAC name is ethyl 2-chloro-2-oxoacetate;ethyl 2-[6-(2-ethoxy-2-oxoacetyl)-9-(2-ethylhexyl)carbazol-3-yl]-2-oxoacetate;9-(2-ethylhexyl)carbazole.
| Compound Name | ethyl 2-chloro-2-oxoacetate;ethyl 2-[6-(2-ethoxy-2-oxoacetyl)-9-(2-ethylhexyl)carbazol-3-yl]-2-oxoacetate;9-(2-ethylhexyl)carbazole |
|---|---|
| PubChem CID | 159593255 |
| Molecular Formula | C52H62ClN2O9+ |
| Molecular Weight | 894.53 g/mol |
| Exact Mass | 893.41 |
| IUPAC Name | ethyl 2-chloro-2-oxoacetate;ethyl 2-[6-(2-ethoxy-2-oxoacetyl)-9-(2-ethylhexyl)carbazol-3-yl]-2-oxoacetate;9-(2-ethylhexyl)carbazole |
| SMILES | CCCCC(CC)Cn1c2ccc(C(=O)C(=O)OCC)cc2c2cc(C(=O)C(=O)OCC)ccc21.CCCCC(CC)Cn1c2ccccc2c2ccccc21.[CH2+]COC(=O)C(=O)Cl |
| InChI | InChI=1S/C28H33NO6.C20H25N.C4H4ClO3/c1-5-9-10-18(6-2)17-29-23-13-11-19(25(30)27(32)34-7-3)15-21(23)22-16-20(12-14-24(22)29)26(31)28(33)35-8-4;1-3-5-10-16(4-2)15-21-19-13-8-6-11-17(19)18-12-7-9-14-20(18)21;1-2-8-4(7)3(5)6/h11-16,18H,5-10,17H2,1-4H3;6-9,11-14,16H,3-5,10,15H2,1-2H3;1-2H2/q;;+1 |
| InChIKey | MKMVBVQFNUGOOP-UHFFFAOYSA-N |
| XLogP | 11.64 |
| TPSA | 139.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 894.53 |
| LogP ≤ 5 | 11.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|