C36H36N2O4 — CID 19982347
1,4-bis(9-butylcarbazol-3-yl)-2,3-dihydroxybutane-1,4-dione (PubChem CID 19982347) has the molecular formula C36H36N2O4 and a molecular weight of 560.69 g/mol. Its IUPAC name is 1,4-bis(9-butylcarbazol-3-yl)-2,3-dihydroxybutane-1,4-dione.
| Compound Name | 1,4-bis(9-butylcarbazol-3-yl)-2,3-dihydroxybutane-1,4-dione |
|---|---|
| PubChem CID | 19982347 |
| Molecular Formula | C36H36N2O4 |
| Molecular Weight | 560.69 g/mol |
| Exact Mass | 560.27 |
| IUPAC Name | 1,4-bis(9-butylcarbazol-3-yl)-2,3-dihydroxybutane-1,4-dione |
| SMILES | CCCCn1c2ccccc2c2cc(C(=O)C(O)C(O)C(=O)c3ccc4c(c3)c3ccccc3n4CCCC)ccc21 |
| InChI | InChI=1S/C36H36N2O4/c1-3-5-19-37-29-13-9-7-11-25(29)27-21-23(15-17-31(27)37)33(39)35(41)36(42)34(40)24-16-18-32-28(22-24)26-12-8-10-14-30(26)38(32)20-6-4-2/h7-18,21-22,35-36,41-42H,3-6,19-20H2,1-2H3 |
| InChIKey | OGOSJOKDCNVQMB-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 84.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.69 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |