C26H25NO3 — CID 135031219
2-(9-hexylcarbazole-3-carbonyl)benzoic acid (PubChem CID 135031219) has the molecular formula C26H25NO3 and a molecular weight of 399.49 g/mol. Its IUPAC name is 2-(9-hexylcarbazole-3-carbonyl)benzoic acid.
| Compound Name | 2-(9-hexylcarbazole-3-carbonyl)benzoic acid |
|---|---|
| PubChem CID | 135031219 |
| Molecular Formula | C26H25NO3 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | 2-(9-hexylcarbazole-3-carbonyl)benzoic acid |
| SMILES | CCCCCCn1c2ccccc2c2cc(C(=O)c3ccccc3C(=O)O)ccc21 |
| InChI | InChI=1S/C26H25NO3/c1-2-3-4-9-16-27-23-13-8-7-10-19(23)22-17-18(14-15-24(22)27)25(28)20-11-5-6-12-21(20)26(29)30/h5-8,10-15,17H,2-4,9,16H2,1H3,(H,29,30) |
| InChIKey | KTRAZENZJHXVEK-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|