4-(9-octylcarbazol-3-yl)oxycarbonylbenzoic acid

C28H29NO4 — CID 175213708

IUPAC4-(9-octylcarbazol-3-yl)oxycarbonylbenzoic acid
SMILESCCCCCCCCn1c2ccccc2c2cc(OC(=O)c3ccc(C(=O)O)cc3)ccc21
InChIInChI=1S/C28H29NO4/c1-2-3-4-5-6-9-18-29-25-11-8-7-10-23(25)24-19-22(16-17-26(24)29)33-28(32)21-14-12-20(13-15-21)27(30)31/h7-8,10-17,19H,2-6,9,18H2,1H3,(H,30,31)
InChIKeySYNUIULDJOTJQL-UHFFFAOYSA-N
MW443.54 g/mol
LogP7.07
Rot. Bonds10

About 4-(9-octylcarbazol-3-yl)oxycarbonylbenzoic acid

4-(9-octylcarbazol-3-yl)oxycarbonylbenzoic acid (PubChem CID 175213708) has the molecular formula C28H29NO4 and a molecular weight of 443.54 g/mol. Its IUPAC name is 4-(9-octylcarbazol-3-yl)oxycarbonylbenzoic acid.

Molecular Properties

Compound Name4-(9-octylcarbazol-3-yl)oxycarbonylbenzoic acid
PubChem CID175213708
Molecular FormulaC28H29NO4
Molecular Weight443.54 g/mol
Exact Mass443.21
IUPAC Name4-(9-octylcarbazol-3-yl)oxycarbonylbenzoic acid
SMILESCCCCCCCCn1c2ccccc2c2cc(OC(=O)c3ccc(C(=O)O)cc3)ccc21
InChIInChI=1S/C28H29NO4/c1-2-3-4-5-6-9-18-29-25-11-8-7-10-23(25)24-19-22(16-17-26(24)29)33-28(32)21-14-12-20(13-15-21)27(30)31/h7-8,10-17,19H,2-6,9,18H2,1H3,(H,30,31)
InChIKeySYNUIULDJOTJQL-UHFFFAOYSA-N
XLogP7.07
TPSA68.53 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds10
Heavy Atoms33
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500443.54
LogP ≤ 57.07
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}

Analyze 4-(9-octylcarbazol-3-yl)oxycarbonylbenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(9-octylcarbazol-3-yl)oxycarbonylbenzoic acid?
The IUPAC name of 4-(9-octylcarbazol-3-yl)oxycarbonylbenzoic acid (CID 175213708) is 4-(9-octylcarbazol-3-yl)oxycarbonylbenzoic acid.
What is the SMILES notation for 4-(9-octylcarbazol-3-yl)oxycarbonylbenzoic acid?
The canonical SMILES for 4-(9-octylcarbazol-3-yl)oxycarbonylbenzoic acid is CCCCCCCCn1c2ccccc2c2cc(OC(=O)c3ccc(C(=O)O)cc3)ccc21.
What is the InChIKey of 4-(9-octylcarbazol-3-yl)oxycarbonylbenzoic acid?
The InChIKey is SYNUIULDJOTJQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H29NO4/c1-2-3-4-5-6-9-18-29-25-11-8-7-10-23(25)24-19-22(16-17-26(24)29)33-28(32)21-14-12-20(13-15-21)27(30)31/h7-8,10-17,19H,2-6,9,18H2,1H3,(H,30,31).
What are the key properties of 4-(9-octylcarbazol-3-yl)oxycarbonylbenzoic acid?
4-(9-octylcarbazol-3-yl)oxycarbonylbenzoic acid has a molecular weight of 443.54 g/mol, XLogP of 7.07, 10 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(9-octylcarbazol-3-yl)oxycarbonylbenzoic acid is sourced from PubChem (CID 175213708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).