C34H29NO6 — CID 135031024
2-[6-(2-carboxybenzoyl)-9-hexylcarbazole-3-carbonyl]benzoic acid (PubChem CID 135031024) has the molecular formula C34H29NO6 and a molecular weight of 547.61 g/mol. Its IUPAC name is 2-[6-(2-carboxybenzoyl)-9-hexylcarbazole-3-carbonyl]benzoic acid.
| Compound Name | 2-[6-(2-carboxybenzoyl)-9-hexylcarbazole-3-carbonyl]benzoic acid |
|---|---|
| PubChem CID | 135031024 |
| Molecular Formula | C34H29NO6 |
| Molecular Weight | 547.61 g/mol |
| Exact Mass | 547.20 |
| IUPAC Name | 2-[6-(2-carboxybenzoyl)-9-hexylcarbazole-3-carbonyl]benzoic acid |
| SMILES | CCCCCCn1c2ccc(C(=O)c3ccccc3C(=O)O)cc2c2cc(C(=O)c3ccccc3C(=O)O)ccc21 |
| InChI | InChI=1S/C34H29NO6/c1-2-3-4-9-18-35-29-16-14-21(31(36)23-10-5-7-12-25(23)33(38)39)19-27(29)28-20-22(15-17-30(28)35)32(37)24-11-6-8-13-26(24)34(40)41/h5-8,10-17,19-20H,2-4,9,18H2,1H3,(H,38,39)(H,40,41) |
| InChIKey | AEKTZZGYCHLSAS-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 113.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.61 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|