C23H21FN2O5 — CID 155358924
[(Z)-[1-(7-benzoyl-2-oxochromen-3-yl)-2-fluoroethylidene]amino] N,N-diethylcarbamate (PubChem CID 155358924) has the molecular formula C23H21FN2O5 and a molecular weight of 424.43 g/mol. Its IUPAC name is [(Z)-[1-(7-benzoyl-2-oxochromen-3-yl)-2-fluoroethylidene]amino] N,N-diethylcarbamate.
| Compound Name | [(Z)-[1-(7-benzoyl-2-oxochromen-3-yl)-2-fluoroethylidene]amino] N,N-diethylcarbamate |
|---|---|
| PubChem CID | 155358924 |
| Molecular Formula | C23H21FN2O5 |
| Molecular Weight | 424.43 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | [(Z)-[1-(7-benzoyl-2-oxochromen-3-yl)-2-fluoroethylidene]amino] N,N-diethylcarbamate |
| SMILES | CCN(CC)C(=O)O/N=C(\CF)c1cc2ccc(C(=O)c3ccccc3)cc2oc1=O |
| InChI | InChI=1S/C23H21FN2O5/c1-3-26(4-2)23(29)31-25-19(14-24)18-12-16-10-11-17(13-20(16)30-22(18)28)21(27)15-8-6-5-7-9-15/h5-13H,3-4,14H2,1-2H3/b25-19+ |
| InChIKey | YSVMGSXTDAODQR-NCELDCMTSA-N |
| XLogP | 4.18 |
| TPSA | 89.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.43 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|