C29H32O5 — CID 89317094
3-benzoyl-7-(11-methyl-10-oxododec-11-enoxy)chromen-2-one (PubChem CID 89317094) has the molecular formula C29H32O5 and a molecular weight of 460.57 g/mol. Its IUPAC name is 3-benzoyl-7-(11-methyl-10-oxododec-11-enoxy)chromen-2-one.
| Compound Name | 3-benzoyl-7-(11-methyl-10-oxododec-11-enoxy)chromen-2-one |
|---|---|
| PubChem CID | 89317094 |
| Molecular Formula | C29H32O5 |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.22 |
| IUPAC Name | 3-benzoyl-7-(11-methyl-10-oxododec-11-enoxy)chromen-2-one |
| SMILES | C=C(C)C(=O)CCCCCCCCCOc1ccc2cc(C(=O)c3ccccc3)c(=O)oc2c1 |
| InChI | InChI=1S/C29H32O5/c1-21(2)26(30)15-11-6-4-3-5-7-12-18-33-24-17-16-23-19-25(29(32)34-27(23)20-24)28(31)22-13-9-8-10-14-22/h8-10,13-14,16-17,19-20H,1,3-7,11-12,15,18H2,2H3 |
| InChIKey | RISNTMCENXUTJD-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 73.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|