3-(7-methoxy-2-oxochromene-3-carbonyl)benzenesulfonyl fluoride

C17H11FO6S — CID 21217318

IUPAC3-(7-methoxy-2-oxochromene-3-carbonyl)benzenesulfonyl fluoride
SMILESCOc1ccc2cc(C(=O)c3cccc(S(=O)(=O)F)c3)c(=O)oc2c1
InChIInChI=1S/C17H11FO6S/c1-23-12-6-5-10-8-14(17(20)24-15(10)9-12)16(19)11-3-2-4-13(7-11)25(18,21)22/h2-9H,1H3
InChIKeyODETURHAHRRRBE-UHFFFAOYSA-N
MW362.33 g/mol
LogP2.69
Rot. Bonds4

About 3-(7-methoxy-2-oxochromene-3-carbonyl)benzenesulfonyl fluoride

3-(7-methoxy-2-oxochromene-3-carbonyl)benzenesulfonyl fluoride (PubChem CID 21217318) has the molecular formula C17H11FO6S and a molecular weight of 362.33 g/mol. Its IUPAC name is 3-(7-methoxy-2-oxochromene-3-carbonyl)benzenesulfonyl fluoride.

Molecular Properties

Compound Name3-(7-methoxy-2-oxochromene-3-carbonyl)benzenesulfonyl fluoride
PubChem CID21217318
Molecular FormulaC17H11FO6S
Molecular Weight362.33 g/mol
Exact Mass362.03
IUPAC Name3-(7-methoxy-2-oxochromene-3-carbonyl)benzenesulfonyl fluoride
SMILESCOc1ccc2cc(C(=O)c3cccc(S(=O)(=O)F)c3)c(=O)oc2c1
InChIInChI=1S/C17H11FO6S/c1-23-12-6-5-10-8-14(17(20)24-15(10)9-12)16(19)11-3-2-4-13(7-11)25(18,21)22/h2-9H,1H3
InChIKeyODETURHAHRRRBE-UHFFFAOYSA-N
XLogP2.69
TPSA90.65 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds4
Heavy Atoms25
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500362.33
LogP ≤ 52.69
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'cumarine', 'substructure': 'N/A'}

Analyze 3-(7-methoxy-2-oxochromene-3-carbonyl)benzenesulfonyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(7-methoxy-2-oxochromene-3-carbonyl)benzenesulfonyl fluoride?
The IUPAC name of 3-(7-methoxy-2-oxochromene-3-carbonyl)benzenesulfonyl fluoride (CID 21217318) is 3-(7-methoxy-2-oxochromene-3-carbonyl)benzenesulfonyl fluoride.
What is the SMILES notation for 3-(7-methoxy-2-oxochromene-3-carbonyl)benzenesulfonyl fluoride?
The canonical SMILES for 3-(7-methoxy-2-oxochromene-3-carbonyl)benzenesulfonyl fluoride is COc1ccc2cc(C(=O)c3cccc(S(=O)(=O)F)c3)c(=O)oc2c1.
What is the InChIKey of 3-(7-methoxy-2-oxochromene-3-carbonyl)benzenesulfonyl fluoride?
The InChIKey is ODETURHAHRRRBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11FO6S/c1-23-12-6-5-10-8-14(17(20)24-15(10)9-12)16(19)11-3-2-4-13(7-11)25(18,21)22/h2-9H,1H3.
What are the key properties of 3-(7-methoxy-2-oxochromene-3-carbonyl)benzenesulfonyl fluoride?
3-(7-methoxy-2-oxochromene-3-carbonyl)benzenesulfonyl fluoride has a molecular weight of 362.33 g/mol, XLogP of 2.69, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(7-methoxy-2-oxochromene-3-carbonyl)benzenesulfonyl fluoride is sourced from PubChem (CID 21217318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).