About 7-methoxy-3-(1-methylpyridin-1-ium-3-carbonyl)chromen-2-one;sulfuric acid;hydrofluoride
7-methoxy-3-(1-methylpyridin-1-ium-3-carbonyl)chromen-2-one;sulfuric acid;hydrofluoride (PubChem CID 118573614) has the molecular formula C17H17FNO8S+
and a molecular weight of 414.39 g/mol. Its IUPAC name is 7-methoxy-3-(1-methylpyridin-1-ium-3-carbonyl)chromen-2-one;sulfuric acid;hydrofluoride.
Molecular Properties
| Compound Name | 7-methoxy-3-(1-methylpyridin-1-ium-3-carbonyl)chromen-2-one;sulfuric acid;hydrofluoride |
| PubChem CID | 118573614 |
| Molecular Formula | C17H17FNO8S+ |
| Molecular Weight | 414.39 g/mol |
| Exact Mass | 414.07 |
| IUPAC Name | 7-methoxy-3-(1-methylpyridin-1-ium-3-carbonyl)chromen-2-one;sulfuric acid;hydrofluoride |
| SMILES | COc1ccc2cc(C(=O)c3ccc[n+](C)c3)c(=O)oc2c1.F.O=S(=O)(O)O |
| InChI | InChI=1S/C17H14NO4.FH.H2O4S/c1-18-7-3-4-12(10-18)16(19)14-8-11-5-6-13(21-2)9-15(11)22-17(14)20;;1-5(2,3)4/h3-10H,1-2H3;1H;(H2,1,2,3,4)/q+1;; |
| InChIKey | NHPLMIMAQUKGFQ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 134.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.39 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 7-methoxy-3-(1-methylpyridin-1-ium-3-carbonyl)chromen-2-one;sulfuric acid;hydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methoxy-3-(1-methylpyridin-1-ium-3-carbonyl)chromen-2-one;sulfuric acid;hydrofluoride?
The IUPAC name of 7-methoxy-3-(1-methylpyridin-1-ium-3-carbonyl)chromen-2-one;sulfuric acid;hydrofluoride (CID 118573614) is 7-methoxy-3-(1-methylpyridin-1-ium-3-carbonyl)chromen-2-one;sulfuric acid;hydrofluoride.
What is the SMILES notation for 7-methoxy-3-(1-methylpyridin-1-ium-3-carbonyl)chromen-2-one;sulfuric acid;hydrofluoride?
The canonical SMILES for 7-methoxy-3-(1-methylpyridin-1-ium-3-carbonyl)chromen-2-one;sulfuric acid;hydrofluoride is COc1ccc2cc(C(=O)c3ccc[n+](C)c3)c(=O)oc2c1.F.O=S(=O)(O)O.
What is the InChIKey of 7-methoxy-3-(1-methylpyridin-1-ium-3-carbonyl)chromen-2-one;sulfuric acid;hydrofluoride?
The InChIKey is NHPLMIMAQUKGFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14NO4.FH.H2O4S/c1-18-7-3-4-12(10-18)16(19)14-8-11-5-6-13(21-2)9-15(11)22-17(14)20;;1-5(2,3)4/h3-10H,1-2H3;1H;(H2,1,2,3,4)/q+1;;.
What are the key properties of 7-methoxy-3-(1-methylpyridin-1-ium-3-carbonyl)chromen-2-one;sulfuric acid;hydrofluoride?
7-methoxy-3-(1-methylpyridin-1-ium-3-carbonyl)chromen-2-one;sulfuric acid;hydrofluoride has a molecular weight of 414.39 g/mol, XLogP of 1.36, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methoxy-3-(1-methylpyridin-1-ium-3-carbonyl)chromen-2-one;sulfuric acid;hydrofluoride is sourced from PubChem (CID 118573614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).