C47H55N3O7 — CID 123496991
[[3-[acetyl(acetyloxy)amino]-1-[5-[4-(cyclopentylmethoxy)benzoyl]-11-(2-ethylhexyl)benzo[a]carbazol-8-yl]butylidene]amino] acetate (PubChem CID 123496991) has the molecular formula C47H55N3O7 and a molecular weight of 773.97 g/mol. Its IUPAC name is [[3-[acetyl(acetyloxy)amino]-1-[5-[4-(cyclopentylmethoxy)benzoyl]-11-(2-ethylhexyl)benzo[a]carbazol-8-yl]butylidene]amino] acetate.
| Compound Name | [[3-[acetyl(acetyloxy)amino]-1-[5-[4-(cyclopentylmethoxy)benzoyl]-11-(2-ethylhexyl)benzo[a]carbazol-8-yl]butylidene]amino] acetate |
|---|---|
| PubChem CID | 123496991 |
| Molecular Formula | C47H55N3O7 |
| Molecular Weight | 773.97 g/mol |
| Exact Mass | 773.40 |
| IUPAC Name | [[3-[acetyl(acetyloxy)amino]-1-[5-[4-(cyclopentylmethoxy)benzoyl]-11-(2-ethylhexyl)benzo[a]carbazol-8-yl]butylidene]amino] acetate |
| SMILES | CCCCC(CC)Cn1c2ccc(C(CC(C)N(OC(C)=O)C(C)=O)=NOC(C)=O)cc2c2cc(C(=O)c3ccc(OCC4CCCC4)cc3)c3ccccc3c21 |
| InChI | InChI=1S/C47H55N3O7/c1-7-9-14-34(8-2)28-49-45-24-21-37(44(48-56-32(5)52)25-30(3)50(31(4)51)57-33(6)53)26-41(45)42-27-43(39-17-12-13-18-40(39)46(42)49)47(54)36-19-22-38(23-20-36)55-29-35-15-10-11-16-35/h12-13,17-24,26-27,30,34-35H,7-11,14-16,25,28-29H2,1-6H3 |
| InChIKey | KECNDFWFZUIPGD-UHFFFAOYSA-N |
| XLogP | 10.34 |
| TPSA | 116.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 773.97 |
| LogP ≤ 5 | 10.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|