C29H29N3O6S — CID 59500062
[(E)-[3-[acetyl(acetyloxy)amino]-1-[9-ethyl-6-(thiophene-2-carbonyl)carbazol-3-yl]butylidene]amino] acetate (PubChem CID 59500062) has the molecular formula C29H29N3O6S and a molecular weight of 547.63 g/mol. Its IUPAC name is [(E)-[3-[acetyl(acetyloxy)amino]-1-[9-ethyl-6-(thiophene-2-carbonyl)carbazol-3-yl]butylidene]amino] acetate.
| Compound Name | [(E)-[3-[acetyl(acetyloxy)amino]-1-[9-ethyl-6-(thiophene-2-carbonyl)carbazol-3-yl]butylidene]amino] acetate |
|---|---|
| PubChem CID | 59500062 |
| Molecular Formula | C29H29N3O6S |
| Molecular Weight | 547.63 g/mol |
| Exact Mass | 547.18 |
| IUPAC Name | [(E)-[3-[acetyl(acetyloxy)amino]-1-[9-ethyl-6-(thiophene-2-carbonyl)carbazol-3-yl]butylidene]amino] acetate |
| SMILES | CCn1c2ccc(C(=O)c3cccs3)cc2c2cc(/C(CC(C)N(OC(C)=O)C(C)=O)=N/OC(C)=O)ccc21 |
| InChI | InChI=1S/C29H29N3O6S/c1-6-31-26-11-9-21(25(30-37-19(4)34)14-17(2)32(18(3)33)38-20(5)35)15-23(26)24-16-22(10-12-27(24)31)29(36)28-8-7-13-39-28/h7-13,15-17H,6,14H2,1-5H3/b30-25+ |
| InChIKey | HIHDNYBLDPGUSK-QCWLDUFUSA-N |
| XLogP | 5.48 |
| TPSA | 107.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.63 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|