About [1-amino-3-[1-(2,2-dimethylpropyl)piperidin-4-yl]indol-5-yl]-thiophen-2-ylmethanone
[1-amino-3-[1-(2,2-dimethylpropyl)piperidin-4-yl]indol-5-yl]-thiophen-2-ylmethanone (PubChem CID 151518551) has the molecular formula C23H29N3OS
and a molecular weight of 395.57 g/mol. Its IUPAC name is [1-amino-3-[1-(2,2-dimethylpropyl)piperidin-4-yl]indol-5-yl]-thiophen-2-ylmethanone.
Molecular Properties
| Compound Name | [1-amino-3-[1-(2,2-dimethylpropyl)piperidin-4-yl]indol-5-yl]-thiophen-2-ylmethanone |
| PubChem CID | 151518551 |
| Molecular Formula | C23H29N3OS |
| Molecular Weight | 395.57 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | [1-amino-3-[1-(2,2-dimethylpropyl)piperidin-4-yl]indol-5-yl]-thiophen-2-ylmethanone |
| SMILES | CC(C)(C)CN1CCC(c2cn(N)c3ccc(C(=O)c4cccs4)cc23)CC1 |
| InChI | InChI=1S/C23H29N3OS/c1-23(2,3)15-25-10-8-16(9-11-25)19-14-26(24)20-7-6-17(13-18(19)20)22(27)21-5-4-12-28-21/h4-7,12-14,16H,8-11,15,24H2,1-3H3 |
| InChIKey | PTZDYAMVESAJIK-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 51.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.57 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1-amino-3-[1-(2,2-dimethylpropyl)piperidin-4-yl]indol-5-yl]-thiophen-2-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-amino-3-[1-(2,2-dimethylpropyl)piperidin-4-yl]indol-5-yl]-thiophen-2-ylmethanone?
The IUPAC name of [1-amino-3-[1-(2,2-dimethylpropyl)piperidin-4-yl]indol-5-yl]-thiophen-2-ylmethanone (CID 151518551) is [1-amino-3-[1-(2,2-dimethylpropyl)piperidin-4-yl]indol-5-yl]-thiophen-2-ylmethanone.
What is the SMILES notation for [1-amino-3-[1-(2,2-dimethylpropyl)piperidin-4-yl]indol-5-yl]-thiophen-2-ylmethanone?
The canonical SMILES for [1-amino-3-[1-(2,2-dimethylpropyl)piperidin-4-yl]indol-5-yl]-thiophen-2-ylmethanone is CC(C)(C)CN1CCC(c2cn(N)c3ccc(C(=O)c4cccs4)cc23)CC1.
What is the InChIKey of [1-amino-3-[1-(2,2-dimethylpropyl)piperidin-4-yl]indol-5-yl]-thiophen-2-ylmethanone?
The InChIKey is PTZDYAMVESAJIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H29N3OS/c1-23(2,3)15-25-10-8-16(9-11-25)19-14-26(24)20-7-6-17(13-18(19)20)22(27)21-5-4-12-28-21/h4-7,12-14,16H,8-11,15,24H2,1-3H3.
What are the key properties of [1-amino-3-[1-(2,2-dimethylpropyl)piperidin-4-yl]indol-5-yl]-thiophen-2-ylmethanone?
[1-amino-3-[1-(2,2-dimethylpropyl)piperidin-4-yl]indol-5-yl]-thiophen-2-ylmethanone has a molecular weight of 395.57 g/mol, XLogP of 4.87, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-amino-3-[1-(2,2-dimethylpropyl)piperidin-4-yl]indol-5-yl]-thiophen-2-ylmethanone is sourced from PubChem (CID 151518551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).