C17H29N3OS — CID 120854150
N-[1-(2-amino-2-methylpropyl)piperidin-4-yl]-N-propylthiophene-2-carboxamide (PubChem CID 120854150) has the molecular formula C17H29N3OS and a molecular weight of 323.51 g/mol. Its IUPAC name is N-[1-(2-amino-2-methylpropyl)piperidin-4-yl]-N-propylthiophene-2-carboxamide.
| Compound Name | N-[1-(2-amino-2-methylpropyl)piperidin-4-yl]-N-propylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 120854150 |
| Molecular Formula | C17H29N3OS |
| Molecular Weight | 323.51 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | N-[1-(2-amino-2-methylpropyl)piperidin-4-yl]-N-propylthiophene-2-carboxamide |
| SMILES | CCCN(C(=O)c1cccs1)C1CCN(CC(C)(C)N)CC1 |
| InChI | InChI=1S/C17H29N3OS/c1-4-9-20(16(21)15-6-5-12-22-15)14-7-10-19(11-8-14)13-17(2,3)18/h5-6,12,14H,4,7-11,13,18H2,1-3H3 |
| InChIKey | JTLFIIACVZOOKF-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.51 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |