C18H21N5OS — CID 133421368
N-[1-(6-cyanopyridazin-3-yl)piperidin-4-yl]-N-propylthiophene-2-carboxamide (PubChem CID 133421368) has the molecular formula C18H21N5OS and a molecular weight of 355.47 g/mol. Its IUPAC name is N-[1-(6-cyanopyridazin-3-yl)piperidin-4-yl]-N-propylthiophene-2-carboxamide.
| Compound Name | N-[1-(6-cyanopyridazin-3-yl)piperidin-4-yl]-N-propylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 133421368 |
| Molecular Formula | C18H21N5OS |
| Molecular Weight | 355.47 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | N-[1-(6-cyanopyridazin-3-yl)piperidin-4-yl]-N-propylthiophene-2-carboxamide |
| SMILES | CCCN(C(=O)c1cccs1)C1CCN(c2ccc(C#N)nn2)CC1 |
| InChI | InChI=1S/C18H21N5OS/c1-2-9-23(18(24)16-4-3-12-25-16)15-7-10-22(11-8-15)17-6-5-14(13-19)20-21-17/h3-6,12,15H,2,7-11H2,1H3 |
| InChIKey | LOGLUWVZWRJELD-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 73.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.47 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |