C11H16ClN5 — CID 121283820
6-[4-(methylamino)piperidin-1-yl]pyridazine-3-carbonitrile;hydrochloride (PubChem CID 121283820) has the molecular formula C11H16ClN5 and a molecular weight of 253.74 g/mol. Its IUPAC name is 6-[4-(methylamino)piperidin-1-yl]pyridazine-3-carbonitrile;hydrochloride.
| Compound Name | 6-[4-(methylamino)piperidin-1-yl]pyridazine-3-carbonitrile;hydrochloride |
|---|---|
| PubChem CID | 121283820 |
| Molecular Formula | C11H16ClN5 |
| Molecular Weight | 253.74 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 6-[4-(methylamino)piperidin-1-yl]pyridazine-3-carbonitrile;hydrochloride |
| SMILES | CNC1CCN(c2ccc(C#N)nn2)CC1.Cl |
| InChI | InChI=1S/C11H15N5.ClH/c1-13-9-4-6-16(7-5-9)11-3-2-10(8-12)14-15-11;/h2-3,9,13H,4-7H2,1H3;1H |
| InChIKey | SOAGTWAGMIFSPA-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 64.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.74 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |