C21H27N5O2 — CID 145425836
N-[1-(6-cyanopyridazin-3-yl)pyrrolidin-3-yl]-2-(4-propan-2-ylphenyl)acetamide;methanol (PubChem CID 145425836) has the molecular formula C21H27N5O2 and a molecular weight of 381.48 g/mol. Its IUPAC name is N-[1-(6-cyanopyridazin-3-yl)pyrrolidin-3-yl]-2-(4-propan-2-ylphenyl)acetamide;methanol.
| Compound Name | N-[1-(6-cyanopyridazin-3-yl)pyrrolidin-3-yl]-2-(4-propan-2-ylphenyl)acetamide;methanol |
|---|---|
| PubChem CID | 145425836 |
| Molecular Formula | C21H27N5O2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | N-[1-(6-cyanopyridazin-3-yl)pyrrolidin-3-yl]-2-(4-propan-2-ylphenyl)acetamide;methanol |
| SMILES | CC(C)c1ccc(CC(=O)NC2CCN(c3ccc(C#N)nn3)C2)cc1.CO |
| InChI | InChI=1S/C20H23N5O.CH4O/c1-14(2)16-5-3-15(4-6-16)11-20(26)22-18-9-10-25(13-18)19-8-7-17(12-21)23-24-19;1-2/h3-8,14,18H,9-11,13H2,1-2H3,(H,22,26);2H,1H3 |
| InChIKey | PBBZLZOAAJKCIP-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 102.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |