C19H21N5O2 — CID 139547658
(4-propan-2-ylphenyl) 4-(6-cyanopyridazin-3-yl)piperazine-1-carboxylate (PubChem CID 139547658) has the molecular formula C19H21N5O2 and a molecular weight of 351.41 g/mol. Its IUPAC name is (4-propan-2-ylphenyl) 4-(6-cyanopyridazin-3-yl)piperazine-1-carboxylate.
| Compound Name | (4-propan-2-ylphenyl) 4-(6-cyanopyridazin-3-yl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 139547658 |
| Molecular Formula | C19H21N5O2 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | (4-propan-2-ylphenyl) 4-(6-cyanopyridazin-3-yl)piperazine-1-carboxylate |
| SMILES | CC(C)c1ccc(OC(=O)N2CCN(c3ccc(C#N)nn3)CC2)cc1 |
| InChI | InChI=1S/C19H21N5O2/c1-14(2)15-3-6-17(7-4-15)26-19(25)24-11-9-23(10-12-24)18-8-5-16(13-20)21-22-18/h3-8,14H,9-12H2,1-2H3 |
| InChIKey | OLRDMRXCXBJGDL-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 82.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |