C21H24N4O2 — CID 139548138
(4-propan-2-ylphenyl) 4-(6-ethynylpyridazin-3-yl)-3-methylpiperazine-1-carboxylate (PubChem CID 139548138) has the molecular formula C21H24N4O2 and a molecular weight of 364.45 g/mol. Its IUPAC name is (4-propan-2-ylphenyl) 4-(6-ethynylpyridazin-3-yl)-3-methylpiperazine-1-carboxylate.
| Compound Name | (4-propan-2-ylphenyl) 4-(6-ethynylpyridazin-3-yl)-3-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 139548138 |
| Molecular Formula | C21H24N4O2 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | (4-propan-2-ylphenyl) 4-(6-ethynylpyridazin-3-yl)-3-methylpiperazine-1-carboxylate |
| SMILES | C#Cc1ccc(N2CCN(C(=O)Oc3ccc(C(C)C)cc3)CC2C)nn1 |
| InChI | InChI=1S/C21H24N4O2/c1-5-18-8-11-20(23-22-18)25-13-12-24(14-16(25)4)21(26)27-19-9-6-17(7-10-19)15(2)3/h1,6-11,15-16H,12-14H2,2-4H3 |
| InChIKey | FDCQPKBZZFQLFR-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|