C19H27NO3 — CID 86921159
(4-propan-2-ylphenyl) 1-(2-methylpropanoyl)piperidine-4-carboxylate (PubChem CID 86921159) has the molecular formula C19H27NO3 and a molecular weight of 317.43 g/mol. Its IUPAC name is (4-propan-2-ylphenyl) 1-(2-methylpropanoyl)piperidine-4-carboxylate.
| Compound Name | (4-propan-2-ylphenyl) 1-(2-methylpropanoyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 86921159 |
| Molecular Formula | C19H27NO3 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | (4-propan-2-ylphenyl) 1-(2-methylpropanoyl)piperidine-4-carboxylate |
| SMILES | CC(C)C(=O)N1CCC(C(=O)Oc2ccc(C(C)C)cc2)CC1 |
| InChI | InChI=1S/C19H27NO3/c1-13(2)15-5-7-17(8-6-15)23-19(22)16-9-11-20(12-10-16)18(21)14(3)4/h5-8,13-14,16H,9-12H2,1-4H3 |
| InChIKey | CNUUGTNJSIHZGM-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|