C20H30N2O4 — CID 108880493
ethyl 1-[1-(4-propan-2-ylphenoxy)ethylcarbamoyl]piperidine-4-carboxylate (PubChem CID 108880493) has the molecular formula C20H30N2O4 and a molecular weight of 362.47 g/mol. Its IUPAC name is ethyl 1-[1-(4-propan-2-ylphenoxy)ethylcarbamoyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[1-(4-propan-2-ylphenoxy)ethylcarbamoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 108880493 |
| Molecular Formula | C20H30N2O4 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | ethyl 1-[1-(4-propan-2-ylphenoxy)ethylcarbamoyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)NC(C)Oc2ccc(C(C)C)cc2)CC1 |
| InChI | InChI=1S/C20H30N2O4/c1-5-25-19(23)17-10-12-22(13-11-17)20(24)21-15(4)26-18-8-6-16(7-9-18)14(2)3/h6-9,14-15,17H,5,10-13H2,1-4H3,(H,21,24) |
| InChIKey | RWCRVPGSBJXISV-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|