C18H26N2O3 — CID 42695560
ethyl 1-[(4-propan-2-ylphenyl)carbamoyl]piperidine-3-carboxylate (PubChem CID 42695560) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is ethyl 1-[(4-propan-2-ylphenyl)carbamoyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[(4-propan-2-ylphenyl)carbamoyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 42695560 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | ethyl 1-[(4-propan-2-ylphenyl)carbamoyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(C(=O)Nc2ccc(C(C)C)cc2)C1 |
| InChI | InChI=1S/C18H26N2O3/c1-4-23-17(21)15-6-5-11-20(12-15)18(22)19-16-9-7-14(8-10-16)13(2)3/h7-10,13,15H,4-6,11-12H2,1-3H3,(H,19,22) |
| InChIKey | OBHGLEDGKAWUTM-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |