C16H21ClN2O3 — CID 3261941
ethyl 1-[(3-chloro-4-methylphenyl)carbamoyl]piperidine-3-carboxylate (PubChem CID 3261941) has the molecular formula C16H21ClN2O3 and a molecular weight of 324.81 g/mol. Its IUPAC name is ethyl 1-[(3-chloro-4-methylphenyl)carbamoyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[(3-chloro-4-methylphenyl)carbamoyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 3261941 |
| Molecular Formula | C16H21ClN2O3 |
| Molecular Weight | 324.81 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | ethyl 1-[(3-chloro-4-methylphenyl)carbamoyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(C(=O)Nc2ccc(C)c(Cl)c2)C1 |
| InChI | InChI=1S/C16H21ClN2O3/c1-3-22-15(20)12-5-4-8-19(10-12)16(21)18-13-7-6-11(2)14(17)9-13/h6-7,9,12H,3-5,8,10H2,1-2H3,(H,18,21) |
| InChIKey | BSISAYMJAYUMNU-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.81 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |