C21H22ClNO3S — CID 58649395
(4-ethylsulfanylphenyl) 1-(4-chlorobenzoyl)piperidine-4-carboxylate (PubChem CID 58649395) has the molecular formula C21H22ClNO3S and a molecular weight of 403.93 g/mol. Its IUPAC name is (4-ethylsulfanylphenyl) 1-(4-chlorobenzoyl)piperidine-4-carboxylate.
| Compound Name | (4-ethylsulfanylphenyl) 1-(4-chlorobenzoyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 58649395 |
| Molecular Formula | C21H22ClNO3S |
| Molecular Weight | 403.93 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | (4-ethylsulfanylphenyl) 1-(4-chlorobenzoyl)piperidine-4-carboxylate |
| SMILES | CCSc1ccc(OC(=O)C2CCN(C(=O)c3ccc(Cl)cc3)CC2)cc1 |
| InChI | InChI=1S/C21H22ClNO3S/c1-2-27-19-9-7-18(8-10-19)26-21(25)16-11-13-23(14-12-16)20(24)15-3-5-17(22)6-4-15/h3-10,16H,2,11-14H2,1H3 |
| InChIKey | IZVSYCUTSOYAPO-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.93 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|