C15H18ClNO4 — CID 127548047
1-O-(4-chlorophenyl) 4-O-ethyl piperidine-1,4-dicarboxylate (PubChem CID 127548047) has the molecular formula C15H18ClNO4 and a molecular weight of 311.76 g/mol. Its IUPAC name is 1-O-(4-chlorophenyl) 4-O-ethyl piperidine-1,4-dicarboxylate.
| Compound Name | 1-O-(4-chlorophenyl) 4-O-ethyl piperidine-1,4-dicarboxylate |
|---|---|
| PubChem CID | 127548047 |
| Molecular Formula | C15H18ClNO4 |
| Molecular Weight | 311.76 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 1-O-(4-chlorophenyl) 4-O-ethyl piperidine-1,4-dicarboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)Oc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C15H18ClNO4/c1-2-20-14(18)11-7-9-17(10-8-11)15(19)21-13-5-3-12(16)4-6-13/h3-6,11H,2,7-10H2,1H3 |
| InChIKey | NEZMMNMORNDPIE-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.76 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |