C16H21ClN2O2S — CID 59347508
ethyl 1-[N-(4-chlorophenyl)-C-methylsulfanylcarbonimidoyl]piperidine-4-carboxylate (PubChem CID 59347508) has the molecular formula C16H21ClN2O2S and a molecular weight of 340.88 g/mol. Its IUPAC name is ethyl 1-[N-(4-chlorophenyl)-C-methylsulfanylcarbonimidoyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[N-(4-chlorophenyl)-C-methylsulfanylcarbonimidoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 59347508 |
| Molecular Formula | C16H21ClN2O2S |
| Molecular Weight | 340.88 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | ethyl 1-[N-(4-chlorophenyl)-C-methylsulfanylcarbonimidoyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(/C(=N/c2ccc(Cl)cc2)SC)CC1 |
| InChI | InChI=1S/C16H21ClN2O2S/c1-3-21-15(20)12-8-10-19(11-9-12)16(22-2)18-14-6-4-13(17)5-7-14/h4-7,12H,3,8-11H2,1-2H3/b18-16- |
| InChIKey | SEARFQSMEUXEQD-VLGSPTGOSA-N |
| XLogP | 3.97 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.88 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|