C27H27ClN2O6S — CID 16550879
[4-[(4-methoxyphenyl)sulfonyl-methylamino]phenyl] 1-(4-chlorobenzoyl)piperidine-4-carboxylate (PubChem CID 16550879) has the molecular formula C27H27ClN2O6S and a molecular weight of 543.04 g/mol. Its IUPAC name is [4-[(4-methoxyphenyl)sulfonyl-methylamino]phenyl] 1-(4-chlorobenzoyl)piperidine-4-carboxylate.
| Compound Name | [4-[(4-methoxyphenyl)sulfonyl-methylamino]phenyl] 1-(4-chlorobenzoyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 16550879 |
| Molecular Formula | C27H27ClN2O6S |
| Molecular Weight | 543.04 g/mol |
| Exact Mass | 542.13 |
| IUPAC Name | [4-[(4-methoxyphenyl)sulfonyl-methylamino]phenyl] 1-(4-chlorobenzoyl)piperidine-4-carboxylate |
| SMILES | COc1ccc(S(=O)(=O)N(C)c2ccc(OC(=O)C3CCN(C(=O)c4ccc(Cl)cc4)CC3)cc2)cc1 |
| InChI | InChI=1S/C27H27ClN2O6S/c1-29(37(33,34)25-13-11-23(35-2)12-14-25)22-7-9-24(10-8-22)36-27(32)20-15-17-30(18-16-20)26(31)19-3-5-21(28)6-4-19/h3-14,20H,15-18H2,1-2H3 |
| InChIKey | CKFLOQAFDYLCMZ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.04 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|