C22H25NO4S — CID 58649393
(4-ethylsulfanylphenyl) 1-(4-methoxybenzoyl)piperidine-4-carboxylate (PubChem CID 58649393) has the molecular formula C22H25NO4S and a molecular weight of 399.51 g/mol. Its IUPAC name is (4-ethylsulfanylphenyl) 1-(4-methoxybenzoyl)piperidine-4-carboxylate.
| Compound Name | (4-ethylsulfanylphenyl) 1-(4-methoxybenzoyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 58649393 |
| Molecular Formula | C22H25NO4S |
| Molecular Weight | 399.51 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | (4-ethylsulfanylphenyl) 1-(4-methoxybenzoyl)piperidine-4-carboxylate |
| SMILES | CCSc1ccc(OC(=O)C2CCN(C(=O)c3ccc(OC)cc3)CC2)cc1 |
| InChI | InChI=1S/C22H25NO4S/c1-3-28-20-10-8-19(9-11-20)27-22(25)17-12-14-23(15-13-17)21(24)16-4-6-18(26-2)7-5-16/h4-11,17H,3,12-15H2,1-2H3 |
| InChIKey | OLUUFBZPDHCLMG-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.51 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|