C16H13Cl2N5O — CID 133433565
6-[4-(3,5-dichlorobenzoyl)piperazin-1-yl]pyridazine-3-carbonitrile (PubChem CID 133433565) has the molecular formula C16H13Cl2N5O and a molecular weight of 362.22 g/mol. Its IUPAC name is 6-[4-(3,5-dichlorobenzoyl)piperazin-1-yl]pyridazine-3-carbonitrile.
| Compound Name | 6-[4-(3,5-dichlorobenzoyl)piperazin-1-yl]pyridazine-3-carbonitrile |
|---|---|
| PubChem CID | 133433565 |
| Molecular Formula | C16H13Cl2N5O |
| Molecular Weight | 362.22 g/mol |
| Exact Mass | 361.05 |
| IUPAC Name | 6-[4-(3,5-dichlorobenzoyl)piperazin-1-yl]pyridazine-3-carbonitrile |
| SMILES | N#Cc1ccc(N2CCN(C(=O)c3cc(Cl)cc(Cl)c3)CC2)nn1 |
| InChI | InChI=1S/C16H13Cl2N5O/c17-12-7-11(8-13(18)9-12)16(24)23-5-3-22(4-6-23)15-2-1-14(10-19)20-21-15/h1-2,7-9H,3-6H2 |
| InChIKey | CWXMDIRYFKDEOJ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 73.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.22 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |