C20H25N5O — CID 167119983
6-[(3R)-3-[[1-hydroxy-2-(4-propan-2-ylphenyl)ethyl]amino]pyrrolidin-1-yl]pyridazine-3-carbonitrile (PubChem CID 167119983) has the molecular formula C20H25N5O and a molecular weight of 351.45 g/mol. Its IUPAC name is 6-[(3R)-3-[[1-hydroxy-2-(4-propan-2-ylphenyl)ethyl]amino]pyrrolidin-1-yl]pyridazine-3-carbonitrile.
| Compound Name | 6-[(3R)-3-[[1-hydroxy-2-(4-propan-2-ylphenyl)ethyl]amino]pyrrolidin-1-yl]pyridazine-3-carbonitrile |
|---|---|
| PubChem CID | 167119983 |
| Molecular Formula | C20H25N5O |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.21 |
| IUPAC Name | 6-[(3R)-3-[[1-hydroxy-2-(4-propan-2-ylphenyl)ethyl]amino]pyrrolidin-1-yl]pyridazine-3-carbonitrile |
| SMILES | CC(C)c1ccc(CC(O)N[C@@H]2CCN(c3ccc(C#N)nn3)C2)cc1 |
| InChI | InChI=1S/C20H25N5O/c1-14(2)16-5-3-15(4-6-16)11-20(26)22-18-9-10-25(13-18)19-8-7-17(12-21)23-24-19/h3-8,14,18,20,22,26H,9-11,13H2,1-2H3/t18-,20?/m1/s1 |
| InChIKey | GCLQWIWOPRTNFO-QSVWIEALSA-N |
| XLogP | 2.20 |
| TPSA | 85.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|