C26H29N3O6 — CID 67638305
[1-amino-3-(1-methylpiperidin-4-yl)indol-5-yl]-(4-methoxyphenyl)methanone;(E)-but-2-enedioic acid (PubChem CID 67638305) has the molecular formula C26H29N3O6 and a molecular weight of 479.53 g/mol. Its IUPAC name is [1-amino-3-(1-methylpiperidin-4-yl)indol-5-yl]-(4-methoxyphenyl)methanone;(E)-but-2-enedioic acid.
| Compound Name | [1-amino-3-(1-methylpiperidin-4-yl)indol-5-yl]-(4-methoxyphenyl)methanone;(E)-but-2-enedioic acid |
|---|---|
| PubChem CID | 67638305 |
| Molecular Formula | C26H29N3O6 |
| Molecular Weight | 479.53 g/mol |
| Exact Mass | 479.21 |
| IUPAC Name | [1-amino-3-(1-methylpiperidin-4-yl)indol-5-yl]-(4-methoxyphenyl)methanone;(E)-but-2-enedioic acid |
| SMILES | COc1ccc(C(=O)c2ccc3c(c2)c(C2CCN(C)CC2)cn3N)cc1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C22H25N3O2.C4H4O4/c1-24-11-9-15(10-12-24)20-14-25(23)21-8-5-17(13-19(20)21)22(26)16-3-6-18(27-2)7-4-16;5-3(6)1-2-4(7)8/h3-8,13-15H,9-12,23H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | RFQXTAOKYSDFCQ-WLHGVMLRSA-N |
| XLogP | 3.12 |
| TPSA | 135.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.53 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|