C25H26ClN3O5 — CID 67638184
[1-amino-3-(1-methylpiperidin-4-yl)indol-5-yl]-(4-chlorophenyl)methanone;(E)-but-2-enedioic acid (PubChem CID 67638184) has the molecular formula C25H26ClN3O5 and a molecular weight of 483.95 g/mol. Its IUPAC name is [1-amino-3-(1-methylpiperidin-4-yl)indol-5-yl]-(4-chlorophenyl)methanone;(E)-but-2-enedioic acid.
| Compound Name | [1-amino-3-(1-methylpiperidin-4-yl)indol-5-yl]-(4-chlorophenyl)methanone;(E)-but-2-enedioic acid |
|---|---|
| PubChem CID | 67638184 |
| Molecular Formula | C25H26ClN3O5 |
| Molecular Weight | 483.95 g/mol |
| Exact Mass | 483.16 |
| IUPAC Name | [1-amino-3-(1-methylpiperidin-4-yl)indol-5-yl]-(4-chlorophenyl)methanone;(E)-but-2-enedioic acid |
| SMILES | CN1CCC(c2cn(N)c3ccc(C(=O)c4ccc(Cl)cc4)cc23)CC1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C21H22ClN3O.C4H4O4/c1-24-10-8-14(9-11-24)19-13-25(23)20-7-4-16(12-18(19)20)21(26)15-2-5-17(22)6-3-15;5-3(6)1-2-4(7)8/h2-7,12-14H,8-11,23H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | NFLNTRUUHMOGRC-WLHGVMLRSA-N |
| XLogP | 3.76 |
| TPSA | 125.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.95 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|