C22H29NO5S — CID 24811226
acetic acid;2-(diethylamino)ethyl 2-[4-(thiophene-2-carbonyl)phenyl]propanoate (PubChem CID 24811226) has the molecular formula C22H29NO5S and a molecular weight of 419.54 g/mol. Its IUPAC name is acetic acid;2-(diethylamino)ethyl 2-[4-(thiophene-2-carbonyl)phenyl]propanoate.
| Compound Name | acetic acid;2-(diethylamino)ethyl 2-[4-(thiophene-2-carbonyl)phenyl]propanoate |
|---|---|
| PubChem CID | 24811226 |
| Molecular Formula | C22H29NO5S |
| Molecular Weight | 419.54 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | acetic acid;2-(diethylamino)ethyl 2-[4-(thiophene-2-carbonyl)phenyl]propanoate |
| SMILES | CC(=O)O.CCN(CC)CCOC(=O)C(C)c1ccc(C(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C20H25NO3S.C2H4O2/c1-4-21(5-2)12-13-24-20(23)15(3)16-8-10-17(11-9-16)19(22)18-7-6-14-25-18;1-2(3)4/h6-11,14-15H,4-5,12-13H2,1-3H3;1H3,(H,3,4) |
| InChIKey | ZCWBBKKUHNROHZ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.54 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |