C23H28ClNO3S — CID 67460945
2-(diethylamino)ethyl 2-(6-oxo-5H-benzo[b][1]benzothiepin-3-yl)propanoate;hydrochloride (PubChem CID 67460945) has the molecular formula C23H28ClNO3S and a molecular weight of 434.00 g/mol. Its IUPAC name is 2-(diethylamino)ethyl 2-(6-oxo-5H-benzo[b][1]benzothiepin-3-yl)propanoate;hydrochloride.
| Compound Name | 2-(diethylamino)ethyl 2-(6-oxo-5H-benzo[b][1]benzothiepin-3-yl)propanoate;hydrochloride |
|---|---|
| PubChem CID | 67460945 |
| Molecular Formula | C23H28ClNO3S |
| Molecular Weight | 434.00 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | 2-(diethylamino)ethyl 2-(6-oxo-5H-benzo[b][1]benzothiepin-3-yl)propanoate;hydrochloride |
| SMILES | CCN(CC)CCOC(=O)C(C)c1ccc2c(c1)CC(=O)c1ccccc1S2.Cl |
| InChI | InChI=1S/C23H27NO3S.ClH/c1-4-24(5-2)12-13-27-23(26)16(3)17-10-11-21-18(14-17)15-20(25)19-8-6-7-9-22(19)28-21;/h6-11,14,16H,4-5,12-13,15H2,1-3H3;1H |
| InChIKey | XIZUVFMUWFZDJN-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.00 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |