About 2-(diethylamino)ethyl 9H-fluorene-9-carboxylate;hydrochloride
2-(diethylamino)ethyl 9H-fluorene-9-carboxylate;hydrochloride (PubChem CID 11058) has the molecular formula C20H24ClNO2
and a molecular weight of 345.87 g/mol. Its IUPAC name is 2-(diethylamino)ethyl 9H-fluorene-9-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | 2-(diethylamino)ethyl 9H-fluorene-9-carboxylate;hydrochloride |
| PubChem CID | 11058 |
| Molecular Formula | C20H24ClNO2 |
| Molecular Weight | 345.87 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | 2-(diethylamino)ethyl 9H-fluorene-9-carboxylate;hydrochloride |
| SMILES | CCN(CC)CCOC(=O)C1c2ccccc2-c2ccccc21.Cl |
| InChI | InChI=1S/C20H23NO2.ClH/c1-3-21(4-2)13-14-23-20(22)19-17-11-7-5-9-15(17)16-10-6-8-12-18(16)19;/h5-12,19H,3-4,13-14H2,1-2H3;1H |
| InChIKey | TYFLIJAGRULBIS-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.87 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(diethylamino)ethyl 9H-fluorene-9-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(diethylamino)ethyl 9H-fluorene-9-carboxylate;hydrochloride?
The IUPAC name of 2-(diethylamino)ethyl 9H-fluorene-9-carboxylate;hydrochloride (CID 11058) is 2-(diethylamino)ethyl 9H-fluorene-9-carboxylate;hydrochloride.
What is the SMILES notation for 2-(diethylamino)ethyl 9H-fluorene-9-carboxylate;hydrochloride?
The canonical SMILES for 2-(diethylamino)ethyl 9H-fluorene-9-carboxylate;hydrochloride is CCN(CC)CCOC(=O)C1c2ccccc2-c2ccccc21.Cl.
What is the InChIKey of 2-(diethylamino)ethyl 9H-fluorene-9-carboxylate;hydrochloride?
The InChIKey is TYFLIJAGRULBIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23NO2.ClH/c1-3-21(4-2)13-14-23-20(22)19-17-11-7-5-9-15(17)16-10-6-8-12-18(16)19;/h5-12,19H,3-4,13-14H2,1-2H3;1H.
What are the key properties of 2-(diethylamino)ethyl 9H-fluorene-9-carboxylate;hydrochloride?
2-(diethylamino)ethyl 9H-fluorene-9-carboxylate;hydrochloride has a molecular weight of 345.87 g/mol, XLogP of 4.11, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(diethylamino)ethyl 9H-fluorene-9-carboxylate;hydrochloride is sourced from PubChem (CID 11058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).