C25H34ClNO2 — CID 138400608
3-(dibutylamino)propyl 9H-fluorene-9-carboxylate;hydrochloride (PubChem CID 138400608) has the molecular formula C25H34ClNO2 and a molecular weight of 416.01 g/mol. Its IUPAC name is 3-(dibutylamino)propyl 9H-fluorene-9-carboxylate;hydrochloride.
| Compound Name | 3-(dibutylamino)propyl 9H-fluorene-9-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 138400608 |
| Molecular Formula | C25H34ClNO2 |
| Molecular Weight | 416.01 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | 3-(dibutylamino)propyl 9H-fluorene-9-carboxylate;hydrochloride |
| SMILES | CCCCN(CCCC)CCCOC(=O)C1c2ccccc2-c2ccccc21.Cl |
| InChI | InChI=1S/C25H33NO2.ClH/c1-3-5-16-26(17-6-4-2)18-11-19-28-25(27)24-22-14-9-7-12-20(22)21-13-8-10-15-23(21)24;/h7-10,12-15,24H,3-6,11,16-19H2,1-2H3;1H |
| InChIKey | BWRQEAMLTRYHGB-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.01 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|