C20H20O5 — CID 70268777
2-hydroxyethyl 9H-fluorene-9-carboxylate;2-methylprop-2-enoic acid (PubChem CID 70268777) has the molecular formula C20H20O5 and a molecular weight of 340.38 g/mol. Its IUPAC name is 2-hydroxyethyl 9H-fluorene-9-carboxylate;2-methylprop-2-enoic acid.
| Compound Name | 2-hydroxyethyl 9H-fluorene-9-carboxylate;2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 70268777 |
| Molecular Formula | C20H20O5 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | 2-hydroxyethyl 9H-fluorene-9-carboxylate;2-methylprop-2-enoic acid |
| SMILES | C=C(C)C(=O)O.O=C(OCCO)C1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C16H14O3.C4H6O2/c17-9-10-19-16(18)15-13-7-3-1-5-11(13)12-6-2-4-8-14(12)15;1-3(2)4(5)6/h1-8,15,17H,9-10H2;1H2,2H3,(H,5,6) |
| InChIKey | IYMKCCGQOWPUFM-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|