C14H14O6 — CID 57249723
1-O-(2-hydroxyethyl) 2-O-(2-methylprop-2-enoyl) benzene-1,2-dicarboxylate (PubChem CID 57249723) has the molecular formula C14H14O6 and a molecular weight of 278.26 g/mol. Its IUPAC name is 1-O-(2-hydroxyethyl) 2-O-(2-methylprop-2-enoyl) benzene-1,2-dicarboxylate.
| Compound Name | 1-O-(2-hydroxyethyl) 2-O-(2-methylprop-2-enoyl) benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 57249723 |
| Molecular Formula | C14H14O6 |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 1-O-(2-hydroxyethyl) 2-O-(2-methylprop-2-enoyl) benzene-1,2-dicarboxylate |
| SMILES | C=C(C)C(=O)OC(=O)c1ccccc1C(=O)OCCO |
| InChI | InChI=1S/C14H14O6/c1-9(2)12(16)20-14(18)11-6-4-3-5-10(11)13(17)19-8-7-15/h3-6,15H,1,7-8H2,2H3 |
| InChIKey | JXGAZZABHYCBQL-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|