C16H18O7 — CID 174428946
1-O-(2,4-dihydroxybutyl) 2-O-(2-methylprop-2-enoyl) benzene-1,2-dicarboxylate (PubChem CID 174428946) has the molecular formula C16H18O7 and a molecular weight of 322.31 g/mol. Its IUPAC name is 1-O-(2,4-dihydroxybutyl) 2-O-(2-methylprop-2-enoyl) benzene-1,2-dicarboxylate.
| Compound Name | 1-O-(2,4-dihydroxybutyl) 2-O-(2-methylprop-2-enoyl) benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 174428946 |
| Molecular Formula | C16H18O7 |
| Molecular Weight | 322.31 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | 1-O-(2,4-dihydroxybutyl) 2-O-(2-methylprop-2-enoyl) benzene-1,2-dicarboxylate |
| SMILES | C=C(C)C(=O)OC(=O)c1ccccc1C(=O)OCC(O)CCO |
| InChI | InChI=1S/C16H18O7/c1-10(2)14(19)23-16(21)13-6-4-3-5-12(13)15(20)22-9-11(18)7-8-17/h3-6,11,17-18H,1,7-9H2,2H3 |
| InChIKey | UGZCKRUOGUNEAC-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.31 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|