C16H25GeNO8 — CID 6380648
CID 6380648 (PubChem CID 6380648) has the molecular formula C16H25GeNO8 and a molecular weight of 431.99 g/mol.
| Compound Name | CID 6380648 |
|---|---|
| PubChem CID | 6380648 |
| Molecular Formula | C16H25GeNO8 |
| Molecular Weight | 431.99 g/mol |
| Exact Mass | 433.08 |
| IUPAC Name | — |
| SMILES | COC(=O)c1ccccc1C(=O)OCC(O)CN(CCO)CCO.O.[Ge] |
| InChI | InChI=1S/C16H23NO7.Ge.H2O/c1-23-15(21)13-4-2-3-5-14(13)16(22)24-11-12(20)10-17(6-8-18)7-9-19;;/h2-5,12,18-20H,6-11H2,1H3;;1H2 |
| InChIKey | RLVFSVVTHJSDJL-UHFFFAOYSA-N |
| XLogP | -1.93 |
| TPSA | 148.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.99 |
| LogP ≤ 5 | -1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |