About [3-(dipropylamino)-2-hydroxypropyl] N-phenylcarbamate;hydrochloride
[3-(dipropylamino)-2-hydroxypropyl] N-phenylcarbamate;hydrochloride (PubChem CID 138401907) has the molecular formula C16H27ClN2O3
and a molecular weight of 330.86 g/mol. Its IUPAC name is [3-(dipropylamino)-2-hydroxypropyl] N-phenylcarbamate;hydrochloride.
Molecular Properties
| Compound Name | [3-(dipropylamino)-2-hydroxypropyl] N-phenylcarbamate;hydrochloride |
| PubChem CID | 138401907 |
| Molecular Formula | C16H27ClN2O3 |
| Molecular Weight | 330.86 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | [3-(dipropylamino)-2-hydroxypropyl] N-phenylcarbamate;hydrochloride |
| SMILES | CCCN(CCC)CC(O)COC(=O)Nc1ccccc1.Cl |
| InChI | InChI=1S/C16H26N2O3.ClH/c1-3-10-18(11-4-2)12-15(19)13-21-16(20)17-14-8-6-5-7-9-14;/h5-9,15,19H,3-4,10-13H2,1-2H3,(H,17,20);1H |
| InChIKey | NUSCCOFOZMCLGF-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.86 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [3-(dipropylamino)-2-hydroxypropyl] N-phenylcarbamate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(dipropylamino)-2-hydroxypropyl] N-phenylcarbamate;hydrochloride?
The IUPAC name of [3-(dipropylamino)-2-hydroxypropyl] N-phenylcarbamate;hydrochloride (CID 138401907) is [3-(dipropylamino)-2-hydroxypropyl] N-phenylcarbamate;hydrochloride.
What is the SMILES notation for [3-(dipropylamino)-2-hydroxypropyl] N-phenylcarbamate;hydrochloride?
The canonical SMILES for [3-(dipropylamino)-2-hydroxypropyl] N-phenylcarbamate;hydrochloride is CCCN(CCC)CC(O)COC(=O)Nc1ccccc1.Cl.
What is the InChIKey of [3-(dipropylamino)-2-hydroxypropyl] N-phenylcarbamate;hydrochloride?
The InChIKey is NUSCCOFOZMCLGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26N2O3.ClH/c1-3-10-18(11-4-2)12-15(19)13-21-16(20)17-14-8-6-5-7-9-14;/h5-9,15,19H,3-4,10-13H2,1-2H3,(H,17,20);1H.
What are the key properties of [3-(dipropylamino)-2-hydroxypropyl] N-phenylcarbamate;hydrochloride?
[3-(dipropylamino)-2-hydroxypropyl] N-phenylcarbamate;hydrochloride has a molecular weight of 330.86 g/mol, XLogP of 3.14, 9 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(dipropylamino)-2-hydroxypropyl] N-phenylcarbamate;hydrochloride is sourced from PubChem (CID 138401907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).