C22H30ClN2O3- — CID 53351492
2-[3-(dipropylamino)-2-hydroxypropoxy]-N-phenylbenzamide chloride (PubChem CID 53351492) has the molecular formula C22H30ClN2O3- and a molecular weight of 405.95 g/mol. Its IUPAC name is 2-[3-(dipropylamino)-2-hydroxypropoxy]-N-phenylbenzamide chloride.
| Compound Name | 2-[3-(dipropylamino)-2-hydroxypropoxy]-N-phenylbenzamide chloride |
|---|---|
| PubChem CID | 53351492 |
| Molecular Formula | C22H30ClN2O3- |
| Molecular Weight | 405.95 g/mol |
| Exact Mass | 405.20 |
| IUPAC Name | 2-[3-(dipropylamino)-2-hydroxypropoxy]-N-phenylbenzamide chloride |
| SMILES | CCCN(CCC)CC(O)COc1ccccc1C(=O)Nc1ccccc1.[Cl-] |
| InChI | InChI=1S/C22H30N2O3.ClH/c1-3-14-24(15-4-2)16-19(25)17-27-21-13-9-8-12-20(21)22(26)23-18-10-6-5-7-11-18;/h5-13,19,25H,3-4,14-17H2,1-2H3,(H,23,26);1H/p-1 |
| InChIKey | HOTYSRJBBDKKBZ-UHFFFAOYSA-M |
| XLogP | 0.80 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.95 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |